D-m-Tyrosine
cas: 32140-49-1 — see every product listed under this CAS number, including other names
D-m-Tyrosine (CAS 32140-49-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092215-1G |
| cas | 32140-49-1 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 924.69 Pln | |
| Fluorochem | 10g | 1445.34 Pln | |
| Fluorochem | 25g | 2923.99 Pln |
properties
| delivery time | 3-4 weeks |
|---|
(2R)-2-amino-3-(3-hydroxyphenyl)propanoic acid (CAS 32140-49-1) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (2R)-2-amino-3-(3-hydroxyphenyl)propanoic acid. InChIKey: JZKXXXDKRQWDET-MRVPVSSYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (2R)-2-amino-3-(3-hydroxyphenyl)propanoic acid |
| InChIKey | JZKXXXDKRQWDET-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)