Products 68229-55-0
CAS 68229-55-0 appears in our catalog under these names: D3-4-Aminoantipyrine, Concentration: 100 µg/ml Solvent: Acetonitrile, D3-4-Aminoantipyrine. Offered by: HPC Standards. Available pack sizes: 1x1ml, 1x10mg.
4-amino-1-methyl-2-phenyl-5-(trideuteriomethyl)pyrazol-3-one (CAS 68229-55-0) is a chemical compound with the molecular formula C11H13N3O and a molecular weight of 206.26 g/mol. IUPAC name: 4-amino-1-methyl-2-phenyl-5-(trideuteriomethyl)pyrazol-3-one. InChIKey: RLFWWDJHLFCNIJ-FIBGUPNXSA-N.
| Molecular formula | C11H13N3O |
|---|---|
| Molecular weight | 206.26 g/mol |
| IUPAC name | 4-amino-1-methyl-2-phenyl-5-(trideuteriomethyl)pyrazol-3-one |
| InChIKey | RLFWWDJHLFCNIJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=O)N(N1C)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)
Synonyms:
orb2300033, orb3026007