CAS 1263303-95-2 appears in our catalog under these names: (E)-2-([1,1'-Biphenyl]-4-ylamino)-N-hydroxy-2-oxoacetimidoyl cyanide, 98%, 98%, DHODH-IN-11/ 99.84% (existing batch purity), DHODH–IN–11, DHODH-IN-11, DHODH-IN-11 98%. Offered by: Chemat, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 1mg, 50mg, 5mg, 25mg, 100mg, 250mg, 2mg, 10mg.
(2E)-2-cyano-2-hydroxyimino-N-(4-phenylphenyl)acetamide (CAS 1263303-95-2) is a chemical compound with the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. IUPAC name: (2E)-2-cyano-2-hydroxyimino-N-(4-phenylphenyl)acetamide. InChIKey: YFGFEIDPJVPFOM-NBVRZTHBSA-N.
| Molecular formula | C15H11N3O2 |
|---|---|
| Molecular weight | 265.27 g/mol |
| IUPAC name | (2E)-2-cyano-2-hydroxyimino-N-(4-phenylphenyl)acetamide |
| InChIKey | YFGFEIDPJVPFOM-NBVRZTHBSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC(=O)/C(=N/O)/C#N |
Computed by PubChem (NCBI)