cas: 16344-26-6 — see every product listed under this CAS number, including other names
DHODH-IN-17, 99.91% (CAS 16344-26-6) is a chemical reagent available from Chemat. Available pack sizes: 5 mg, 10mM/1mL, 25 mg, 10 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-128068-5 mg |
| cas | 16344-26-6 |
| size | 5 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 mg | 505.45 Pln | |
| MedChemExpress | 10mM/1mL | 542.60 Pln | |
| MedChemExpress | 25 mg | 1369.24 Pln | |
| MedChemExpress | 10 mg | 742.30 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.91% |
2-(4-chloroanilino)pyridine-3-carboxylic acid (CAS 16344-26-6) is a chemical compound with the molecular formula C12H9ClN2O2 and a molecular weight of 248.66 g/mol. IUPAC name: 2-(4-chloroanilino)pyridine-3-carboxylic acid. InChIKey: YEXIXVLEDGNAKM-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O2 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | 2-(4-chloroanilino)pyridine-3-carboxylic acid |
| InChIKey | YEXIXVLEDGNAKM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)NC2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)