cas: 334970-30-8 — see every product listed under this CAS number, including other names
DIBENZO[B,D]FURAN-1-OL, 98% (CAS 334970-30-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F505715-250MG |
| cas | 334970-30-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 440.49 Pln | |
| Fluorochem | 5g | 1351.63 Pln | |
| Fluorochem | 10g | 1788.97 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Dibenzofuran-1-ol (CAS 334970-30-8) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: dibenzofuran-1-ol. InChIKey: BIFIUYPXCGSSAG-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | dibenzofuran-1-ol |
| InChIKey | BIFIUYPXCGSSAG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CC=C3O2)O |
Computed by PubChem (NCBI)