CAS 334970-30-8 appears in our catalog under these names: 1-Dibenzofuranol, 95%, DIBENZO[B,D]FURAN-1-OL, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
Dibenzofuran-1-ol (CAS 334970-30-8) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: dibenzofuran-1-ol. InChIKey: BIFIUYPXCGSSAG-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | dibenzofuran-1-ol |
| InChIKey | BIFIUYPXCGSSAG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CC=C3O2)O |
Computed by PubChem (NCBI)