CAS 19261-06-4 appears in our catalog under these names: 4-Dibenzofuranol, 98%, Dibenzofuran-4-ol, 97%, Dibenzo(b,d)furan–4–ol, Dibenzo[b,d]furan-4-ol, 97%, Dibenzo[b,d]furan-4-ol, 97%, 97%. Offered by: Combi-blocks, Fluorochem, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 25g, 50g, 100g.
Dibenzofuran-4-ol (CAS 19261-06-4) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: dibenzofuran-4-ol. InChIKey: ZYGJIKIEQYYOKG-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | dibenzofuran-4-ol |
| InChIKey | ZYGJIKIEQYYOKG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=CC=C3)O |
Computed by PubChem (NCBI)