CAS 494-72-4 appears in our catalog under these names: Propofol Impurity 20, 4,4'-Biphenyldione, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg.
4-(4-oxocyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-dien-1-one (CAS 494-72-4) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: 4-(4-oxocyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-dien-1-one. InChIKey: DDTHMESPCBONDT-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 4-(4-oxocyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-dien-1-one |
| InChIKey | DDTHMESPCBONDT-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)C=CC1=C2C=CC(=O)C=C2 |
Computed by PubChem (NCBI)