CAS 7149-49-7 appears in our catalog under these names: 2,3-Naphthalenedialdehyde, 98%, Naphthalene-2,3-dicarboxaldehyde, >95% (HPLC), 2,3-Naphthalenedicarboxaldehyde, Naphthalene–2,3–Dicarboxaldehyde, 2,3-Naphthalenedialdehyde [Fluorimetric Reagent for Primary Amines], >99.0%(GC). Offered by: Combi-blocks, TRC, TargetMol, GLPBio, TCI. Available pack sizes: 100mg, 1g, 250mg, 50mg, 25mg, 500mg, 10mM (in 1ml dmso), 10g.
Naphthalene-2,3-dicarbaldehyde (CAS 7149-49-7) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: naphthalene-2,3-dicarbaldehyde. InChIKey: ZIPLKLQPLOWLTM-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | naphthalene-2,3-dicarbaldehyde |
| InChIKey | ZIPLKLQPLOWLTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C=O)C=O |
Computed by PubChem (NCBI)