CAS 22115-06-6 is the registry number for 2-(Naphthalen-2-yl)-2-oxoacetaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.
2-naphthalen-2-yl-2-oxoacetaldehyde (CAS 22115-06-6) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: 2-naphthalen-2-yl-2-oxoacetaldehyde. InChIKey: FDZMEYJSJZWIEJ-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2-naphthalen-2-yl-2-oxoacetaldehyde |
| InChIKey | FDZMEYJSJZWIEJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)C=O |
Computed by PubChem (NCBI)