CAS 19997-42-3 is the registry number for 1H,2H-Naphtho[2,1-b]furan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Benzo[e][1]benzofuran-1-one (CAS 19997-42-3) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: benzo[e][1]benzofuran-1-one. InChIKey: IONYAPWXJUCNPR-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | benzo[e][1]benzofuran-1-one |
| InChIKey | IONYAPWXJUCNPR-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(O1)C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)