DJ001
cas: 2161305-12-8 — see every product listed under this CAS number, including other names
DJ001 (CAS 2161305-12-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 50mg, 100mg, 200mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC39295-1 |
| cas | 2161305-12-8 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 919.99 Pln | |
| GLPBio | 10mg | 2141.60 Pln | |
| GLPBio | 5mg | 1593.99 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 2389.67 Pln | |
| Chemat | 1mg | 299.60 Pln | |
| Chemat | 5mg | 626.00 Pln | |
| Chemat | 10mg | 866.00 Pln | |
| Chemat | 25mg | 1403.60 Pln | |
| Chemat | 50mg | 1922.00 Pln | |
| Chemat | 100mg | 2498.00 Pln | |
| Chemat | 200mg | 3395.60 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(Z)-3-(3-nitroanilino)-1-phenylprop-2-en-1-one (CAS 2161305-12-8) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: (Z)-3-(3-nitroanilino)-1-phenylprop-2-en-1-one. InChIKey: OVTJWWUGQKIRCL-KTKRTIGZSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | (Z)-3-(3-nitroanilino)-1-phenylprop-2-en-1-one |
| InChIKey | OVTJWWUGQKIRCL-KTKRTIGZSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C=C\NC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)