cas: 486-66-8 — see every product listed under this CAS number, including other names
Daidzein 98% (CAS 486-66-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A129224-1mg |
| cas | 486-66-8 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 153.44 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 270.25 Pln | |
| Ambeed | 100g | 531.69 Pln | |
| Ambeed | 500g | 1560.75 Pln | |
| Ambeed | 1000g | 2612.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A129224 |
Daidzein is a member of the class of 7-hydroxyisoflavones that is 7-hydroxyisoflavone substituted by an additional hydroxy group at position 4'. It has a role as an EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor, an antineoplastic agent, an EC 3.2.1.20 (alpha-glucosidase) inhibitor, a plant metabolite and a phytoestrogen. It is a conjugate acid of a daidzein(1-).
Source: ChEBI
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 7-hydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| InChIKey | ZQSIJRDFPHDXIC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)O)O |
Computed by PubChem (NCBI)