cas: 622-00-4 — see every product listed under this CAS number, including other names
Dibenzyl L-Tartrate, 96%, 96% (CAS 622-00-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RDG-100mg |
| cas | 622-00-4 |
| size | 100mg |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 318.80 Pln | |
| Chemat | 25g | 885.20 Pln | |
| Chemat | 100g | 3102.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Dibenzyl (2R,3R)-2,3-dihydroxybutanedioate (CAS 622-00-4) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: dibenzyl (2R,3R)-2,3-dihydroxybutanedioate. InChIKey: LCKIPSGLXMCAOF-HZPDHXFCSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | dibenzyl (2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | LCKIPSGLXMCAOF-HZPDHXFCSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@@H]([C@H](C(=O)OCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)