cas: 20605-01-0 — see every product listed under this CAS number, including other names
Diethyl bis(hydroxymethyl)malonate, 95% (CAS 20605-01-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1g, 10g, 1kg. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 189530250 |
| cas | 20605-01-0 |
| size | 25g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 25g | 226.29 Pln | |
| Thermo Scientific (Acros) | 100g | 783.98 Pln | |
| Thermo Scientific (Acros) | 500g | 3750.65 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 169.75 Pln | |
| Fluorochem | 100g | 424.87 Pln | |
| Fluorochem | 500g | 1622.36 Pln | |
| Fluorochem | 1kg | 2986.47 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
Diethyl 2,2-bis(hydroxymethyl)propanedioate (CAS 20605-01-0) is a chemical compound with the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. IUPAC name: diethyl 2,2-bis(hydroxymethyl)propanedioate. InChIKey: WIOHBOKEUIHYIC-UHFFFAOYSA-N.
| Molecular formula | C9H16O6 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | diethyl 2,2-bis(hydroxymethyl)propanedioate |
| InChIKey | WIOHBOKEUIHYIC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CO)(CO)C(=O)OCC |
Computed by PubChem (NCBI)