CAS 359437-02-8 appears in our catalog under these names: Methyl (S)-2-hydroxy-2-((4R,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl)acetate, 98%, Methyl 3,4-O-isopropylidene-D-lyxonate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 500mg, 250mg, 1000mg.
Methyl (2S)-2-hydroxy-2-[(4R,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate (CAS 359437-02-8) is a chemical compound with the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. IUPAC name: methyl (2S)-2-hydroxy-2-[(4R,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate. InChIKey: GKSNEUMZNDKSTN-VQVTYTSYSA-N.
| Molecular formula | C9H16O6 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | methyl (2S)-2-hydroxy-2-[(4R,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate |
| InChIKey | GKSNEUMZNDKSTN-VQVTYTSYSA-N |
| SMILES | CC1(O[C@@H]([C@H](O1)[C@@H](C(=O)OC)O)CO)C |
Computed by PubChem (NCBI)