CAS 7464-56-4 appears in our catalog under these names: Allyl alpha-d-glucopyranoside, 95%, (2S,3R,4S,5S,6R)–2–(Allyloxy)–6–(hydroxymethyl)tetrahydro–2H–pyran–3,4,5–triol, Allyl a-D-glucopyranoside, Allylα-D-glucopyranoside 97%, Allyl α-D-Glucopyranoside, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 2,5g, 25g, 50g.
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-prop-2-enoxyoxane-3,4,5-triol (CAS 7464-56-4) is a chemical compound with the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. IUPAC name: (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-prop-2-enoxyoxane-3,4,5-triol. InChIKey: XJNKZTHFPGIJNS-ZEBDFXRSSA-N.
| Molecular formula | C9H16O6 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-prop-2-enoxyoxane-3,4,5-triol |
| InChIKey | XJNKZTHFPGIJNS-ZEBDFXRSSA-N |
| SMILES | C=CCO[C@@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)