Products 2591381-21-2
CAS 2591381-21-2 appears in our catalog under these names: Mupirocin Impurity 15, Molnupiravir Impurity 3 (Mixture of Diastereomers). Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl 2-methylpropanoate (CAS 2591381-21-2) is a chemical compound with the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. IUPAC name: [(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl 2-methylpropanoate. InChIKey: JEMCWNNEJCOKPW-PILSHRGASA-N.
| Molecular formula | C9H16O6 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | [(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl 2-methylpropanoate |
| InChIKey | JEMCWNNEJCOKPW-PILSHRGASA-N |
| SMILES | CC(C)C(=O)OC[C@@H]1[C@H]([C@H](C(O1)O)O)O |
Computed by PubChem (NCBI)