CAS 912456-61-2 appears in our catalog under these names: Topiramate Impurity 2, Topiramate Impurity 5, Topiramate Impurity 14, 4,5-O-(1-Methylethylidene)-beta-D-fructopyranose, >95% (HPLC), 4,5-O-Isopropylidene-b-D-fructopyranose. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 1000mg.
(3aR,6R,7S,7aS)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6,7-diol (CAS 912456-61-2) is a chemical compound with the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. IUPAC name: (3aR,6R,7S,7aS)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6,7-diol. InChIKey: HSMPYYFZUMECON-JAGXHNFQSA-N.
| Molecular formula | C9H16O6 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | (3aR,6R,7S,7aS)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6,7-diol |
| InChIKey | HSMPYYFZUMECON-JAGXHNFQSA-N |
| SMILES | CC1(O[C@@H]2CO[C@@]([C@H]([C@@H]2O1)O)(CO)O)C |
Computed by PubChem (NCBI)