Products 4469-60-7

CAS 4469-60-7 appears in our catalog under these names: 1,5-Dimethyl 2,2-dimethoxypentanedioate, 95%, Dimethyl 2,2-dimethoxypentanedioate, 98%, 1,5-Dimethyl 2,2-dimethoxypentanedioate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.

Structural formula: {0} (CAS {1})

Dimethyl 2,2-dimethoxypentanedioate (CAS 4469-60-7) is a chemical compound with the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. IUPAC name: dimethyl 2,2-dimethoxypentanedioate. InChIKey: DDOXYXADRPCSSN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O6
Molecular weight220.22 g/mol
IUPAC namedimethyl 2,2-dimethoxypentanedioate
InChIKeyDDOXYXADRPCSSN-UHFFFAOYSA-N
SMILESCOC(=O)CCC(C(=O)OC)(OC)OC

Computed by PubChem (NCBI)