Products 58238-46-3
CAS 58238-46-3 appears in our catalog under these names: Topiramate Impurity 7, Topiramate Impurity 1, Topiramate Impurity 13. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3aS,6R,7R,7aS)-3a-(hydroxymethyl)-2,2-dimethyl-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyran-6,7-diol (CAS 58238-46-3) is a chemical compound with the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. IUPAC name: (3aS,6R,7R,7aS)-3a-(hydroxymethyl)-2,2-dimethyl-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyran-6,7-diol. InChIKey: OQIFFOZGAPOOCK-JAKMQLQISA-N.
| Molecular formula | C9H16O6 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | (3aS,6R,7R,7aS)-3a-(hydroxymethyl)-2,2-dimethyl-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyran-6,7-diol |
| InChIKey | OQIFFOZGAPOOCK-JAKMQLQISA-N |
| SMILES | CC1(O[C@H]2[C@@H]([C@@H](CO[C@]2(O1)CO)O)O)C |
Computed by PubChem (NCBI)