CAS 579-38-4 appears in our catalog under these names: 2,2-Dichloro-N-(4-hydroxyphenyl)-N-methylacetamide, Diloxanide/ 99.27% (existing batch purity), Diloxanide, Diloxanide, 99.66%. Offered by: Biosynth, Chemat, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 250mg, 100mg, 500mg, 1000mg, 25mg, 5mg, 10mg, 50mg.
2,2-dichloro-N-(4-hydroxyphenyl)-N-methylacetamide (CAS 579-38-4) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: 2,2-dichloro-N-(4-hydroxyphenyl)-N-methylacetamide. InChIKey: GZZZSOOGQLOEOB-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 2,2-dichloro-N-(4-hydroxyphenyl)-N-methylacetamide |
| InChIKey | GZZZSOOGQLOEOB-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)O)C(=O)C(Cl)Cl |
Computed by PubChem (NCBI)