cas: 4077-76-3 — see every product listed under this CAS number, including other names
Dimethyl 1H-pyrazole-3,5-dicarboxylate 98% (CAS 4077-76-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A124089-100mg |
| cas | 4077-76-3 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 248.00 Pln | |
| Ambeed | 100g | 592.88 Pln | |
| Ambeed | 500g | 2684.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A124089 |
Dimethyl 1H-pyrazole-3,5-dicarboxylate (CAS 4077-76-3) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: dimethyl 1H-pyrazole-3,5-dicarboxylate. InChIKey: SIPQVJNEQSWAOK-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | dimethyl 1H-pyrazole-3,5-dicarboxylate |
| InChIKey | SIPQVJNEQSWAOK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NN1)C(=O)OC |
Computed by PubChem (NCBI)