CAS 4077-76-3 appears in our catalog under these names: Dimethyl 1H–pyrazole–3,5–dicarboxylate, Dimethyl 1H-pyrazole-3,5-dicarboxylate, Dimethyl 1H-pyrazole-3,5-dicarboxylate 98%, Dimethyl Pyrazole-3,5-dicarboxylate, 98%, 98%, Dimethyl 1H-pyrazole-3,5-dicarboxylate, 96%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 10g, 100mg, 250mg, 1g, 500g.
Dimethyl 1H-pyrazole-3,5-dicarboxylate (CAS 4077-76-3) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: dimethyl 1H-pyrazole-3,5-dicarboxylate. InChIKey: SIPQVJNEQSWAOK-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | dimethyl 1H-pyrazole-3,5-dicarboxylate |
| InChIKey | SIPQVJNEQSWAOK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NN1)C(=O)OC |
Computed by PubChem (NCBI)