cas: 33090-46-9 — see every product listed under this CAS number, including other names
Dimethyl 1H-pyrazole-4,5-dicarboxylate, 97%, 97% (CAS 33090-46-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CKXB-100mg |
| cas | 33090-46-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 1g | 1230.80 Pln | |
| Chemat | 5g | 4197.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Dimethyl 1H-pyrazole-4,5-dicarboxylate (CAS 33090-46-9) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: dimethyl 1H-pyrazole-4,5-dicarboxylate. InChIKey: MBPCNHQXWVYNJQ-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | dimethyl 1H-pyrazole-4,5-dicarboxylate |
| InChIKey | MBPCNHQXWVYNJQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(NN=C1)C(=O)OC |
Computed by PubChem (NCBI)