cas: 2549-47-5 — see every product listed under this CAS number, including other names
Dimethyl 2,7-Naphthalenedicarboxylate, 98%, 98% (CAS 2549-47-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PL4-100mg |
| cas | 2549-47-5 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 669.20 Pln | |
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 10g | 4197.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dimethyl naphthalene-2,7-dicarboxylate (CAS 2549-47-5) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: dimethyl naphthalene-2,7-dicarboxylate. InChIKey: WYIBAMPRACRCOM-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | dimethyl naphthalene-2,7-dicarboxylate |
| InChIKey | WYIBAMPRACRCOM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=CC(=C2)C(=O)OC |
Computed by PubChem (NCBI)