cas: 2549-47-5 — see every product listed under this CAS number, including other names
Dimethyl naphthalene-2,7-dicarboxylate, 98% (CAS 2549-47-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F772273-100MG |
| cas | 2549-47-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 1g | 883.04 Pln | |
| Fluorochem | 5g | 3340.51 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Dimethyl naphthalene-2,7-dicarboxylate (CAS 2549-47-5) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: dimethyl naphthalene-2,7-dicarboxylate. InChIKey: WYIBAMPRACRCOM-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | dimethyl naphthalene-2,7-dicarboxylate |
| InChIKey | WYIBAMPRACRCOM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=CC(=C2)C(=O)OC |
Computed by PubChem (NCBI)