cas: 5292-47-7 — see every product listed under this CAS number, including other names
Dimethyl 2-fluoroterephthalate 98% (CAS 5292-47-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A348316-100g |
| cas | 5292-47-7 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 3908.12 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 470.50 Pln | |
| Ambeed | 25g | 1271.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A348316 |
Dimethyl 2-fluorobenzene-1,4-dicarboxylate (CAS 5292-47-7) is a chemical compound with the molecular formula C10H9FO4 and a molecular weight of 212.17 g/mol. IUPAC name: dimethyl 2-fluorobenzene-1,4-dicarboxylate. InChIKey: NCRFSIQSCLJDIC-UHFFFAOYSA-N.
| Molecular formula | C10H9FO4 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | dimethyl 2-fluorobenzene-1,4-dicarboxylate |
| InChIKey | NCRFSIQSCLJDIC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)OC)F |
Computed by PubChem (NCBI)