cas: 5292-47-7 — see every product listed under this CAS number, including other names
Dimethyl fluoroterephthalate, 98% (CAS 5292-47-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009154-250MG |
| cas | 5292-47-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 2g | 268.67 Pln | |
| Fluorochem | 5g | 435.28 Pln | |
| Fluorochem | 25g | 1226.67 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Dimethyl 2-fluorobenzene-1,4-dicarboxylate (CAS 5292-47-7) is a chemical compound with the molecular formula C10H9FO4 and a molecular weight of 212.17 g/mol. IUPAC name: dimethyl 2-fluorobenzene-1,4-dicarboxylate. InChIKey: NCRFSIQSCLJDIC-UHFFFAOYSA-N.
| Molecular formula | C10H9FO4 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | dimethyl 2-fluorobenzene-1,4-dicarboxylate |
| InChIKey | NCRFSIQSCLJDIC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)OC)F |
Computed by PubChem (NCBI)