Dimethyl 2-fluoroterephthalate, 98%
cas: 5292-47-7 — see every product listed under this CAS number, including other names
Dimethyl 2-fluoroterephthalate, 98% (CAS 5292-47-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A348316-250mg |
| cas | 5292-47-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 470.50 Pln | |
| Ambeed | 25g | 1282.62 Pln | |
| Ambeed | 100g | 3947.06 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 25g | 818.00 Pln | |
| Chemat | 100g | 2478.80 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 503.18 Pln | |
| BLDpharm | 25g | 1375.10 Pln | |
| BLDpharm | 100g | 4251.86 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Dimethyl 2-fluorobenzene-1,4-dicarboxylate (CAS 5292-47-7) is a chemical compound with the molecular formula C10H9FO4 and a molecular weight of 212.17 g/mol. IUPAC name: dimethyl 2-fluorobenzene-1,4-dicarboxylate. InChIKey: NCRFSIQSCLJDIC-UHFFFAOYSA-N.
| Molecular formula | C10H9FO4 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | dimethyl 2-fluorobenzene-1,4-dicarboxylate |
| InChIKey | NCRFSIQSCLJDIC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)OC)F |
Computed by PubChem (NCBI)
Synonyms:
Dimethyl 2-fluoroterephthalate, 1,4-Benzenedicarboxylic acid, 2-fluoro-, 1,4-dimethyl ester, 2-fluoroterephthalic acid dimethyl ester, dimethyl 2-fluorobenzene-1,4-dicarboxylate, Dimethyl fluoroterephthalate, 1,4-dimethyl 2-fluorobenzene-1,4-dicarboxylate, 1,4-Benzenedicarboxylic acid, 2-fluoro-, dimethyl ester, methyl 3-fluoro-4-(methoxycarbonyl)benzoate, Dimethyl 2-fluorobenzene-1,4-dicarb, dimethyl 2-fluorobenzene-1,4-dioate
