cas: 52959-28-1 — see every product listed under this CAS number, including other names
Dimethyl 4,6-dihydroxyisophthalate 97% (CAS 52959-28-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1150560-1g |
| cas | 52959-28-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 181.25 Pln | |
| Ambeed | 5g | 403.75 Pln | |
| Ambeed | 25g | 1199.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1150560 |
Dimethyl 4,6-dihydroxybenzene-1,3-dicarboxylate (CAS 52959-28-1) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: dimethyl 4,6-dihydroxybenzene-1,3-dicarboxylate. InChIKey: CMTOZSKJCALTLF-UHFFFAOYSA-N.
| Molecular formula | C10H10O6 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | dimethyl 4,6-dihydroxybenzene-1,3-dicarboxylate |
| InChIKey | CMTOZSKJCALTLF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1O)O)C(=O)OC |
Computed by PubChem (NCBI)