cas: 52959-28-1 — see every product listed under this CAS number, including other names
Dimethyl 4,6-dihydroxyisophthalate, 98%, 98% (CAS 52959-28-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DLER-100mg |
| cas | 52959-28-1 |
| size | 100mg |
| availability | 105.6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 25g | 606.80 Pln | |
| Chemat | 10g | 294.80 Pln | |
| Chemat | 50g | 1144.40 Pln | |
| Chemat | 100g | 2224.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dimethyl 4,6-dihydroxybenzene-1,3-dicarboxylate (CAS 52959-28-1) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: dimethyl 4,6-dihydroxybenzene-1,3-dicarboxylate. InChIKey: CMTOZSKJCALTLF-UHFFFAOYSA-N.
| Molecular formula | C10H10O6 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | dimethyl 4,6-dihydroxybenzene-1,3-dicarboxylate |
| InChIKey | CMTOZSKJCALTLF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1O)O)C(=O)OC |
Computed by PubChem (NCBI)