cas: 16281-94-0 — see every product listed under this CAS number, including other names
Dimethyl 4-(bromomethyl)isophthalate, 96% (CAS 16281-94-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F459701-100MG |
| cas | 16281-94-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 539.41 Pln | |
| Fluorochem | 250mg | 851.80 Pln | |
| Fluorochem | 1g | 2163.84 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Dimethyl 4-(bromomethyl)benzene-1,3-dicarboxylate (CAS 16281-94-0) is a chemical compound with the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. IUPAC name: dimethyl 4-(bromomethyl)benzene-1,3-dicarboxylate. InChIKey: ANRZBUXUDASAAN-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO4 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | dimethyl 4-(bromomethyl)benzene-1,3-dicarboxylate |
| InChIKey | ANRZBUXUDASAAN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)CBr)C(=O)OC |
Computed by PubChem (NCBI)