CAS 16281-93-9 appears in our catalog under these names: 1,3-Dimethyl 2-(bromomethyl)benzene-1,3-dicarboxylate, 97%, Dimethyl 2-(bromomethyl)isophthalate 98%, Dimethyl 2-(bromomethyl)isophthalate, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg.
Dimethyl 2-(bromomethyl)benzene-1,3-dicarboxylate (CAS 16281-93-9) is a chemical compound with the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. IUPAC name: dimethyl 2-(bromomethyl)benzene-1,3-dicarboxylate. InChIKey: KRJSSQZVMROWLC-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO4 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | dimethyl 2-(bromomethyl)benzene-1,3-dicarboxylate |
| InChIKey | KRJSSQZVMROWLC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)C(=O)OC)CBr |
Computed by PubChem (NCBI)