CAS 57834-13-6 appears in our catalog under these names: Dimethyl 2-(bromomethyl)terephthalate, 97%, dimethyl 2–(bromomethyl)benzene–1,4–dicarboxylate, 2-Bromomethyl-terephthalic acid dimethyl ester 97%, 2-Bromomethyl-terephthalic acid dimethyl ester, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg.
Dimethyl 2-(bromomethyl)benzene-1,4-dicarboxylate (CAS 57834-13-6) is a chemical compound with the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. IUPAC name: dimethyl 2-(bromomethyl)benzene-1,4-dicarboxylate. InChIKey: UTIKNGRWJJKNBJ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO4 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | dimethyl 2-(bromomethyl)benzene-1,4-dicarboxylate |
| InChIKey | UTIKNGRWJJKNBJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)OC)CBr |
Computed by PubChem (NCBI)