CAS 99853-25-5 is the registry number for 2-Bromo-6-ethoxy-4-formylphenyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2-bromo-6-ethoxy-4-formylphenyl) acetate (CAS 99853-25-5) is a chemical compound with the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. IUPAC name: (2-bromo-6-ethoxy-4-formylphenyl) acetate. InChIKey: BMHQLIWJIZLBOY-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO4 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | (2-bromo-6-ethoxy-4-formylphenyl) acetate |
| InChIKey | BMHQLIWJIZLBOY-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C=O)Br)OC(=O)C |
Computed by PubChem (NCBI)