CAS 1415601-70-5 is the registry number for (2E)-3-(5-Bromo-2,4-dimethoxyphenyl)acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-3-(5-bromo-2,4-dimethoxyphenyl)prop-2-enoic acid (CAS 1415601-70-5) is a chemical compound with the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. IUPAC name: (E)-3-(5-bromo-2,4-dimethoxyphenyl)prop-2-enoic acid. InChIKey: BWWHSNRSZPESIE-ONEGZZNKSA-N.
| Molecular formula | C11H11BrO4 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | (E)-3-(5-bromo-2,4-dimethoxyphenyl)prop-2-enoic acid |
| InChIKey | BWWHSNRSZPESIE-ONEGZZNKSA-N |
| SMILES | COC1=CC(=C(C=C1/C=C/C(=O)O)Br)OC |
Computed by PubChem (NCBI)