Products 2270909-77-6
CAS 2270909-77-6 is the registry number for 4-Bromo-3-(oxetan-3-yloxy)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 4-bromo-3-(oxetan-3-yloxy)benzoate (CAS 2270909-77-6) is a chemical compound with the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. IUPAC name: methyl 4-bromo-3-(oxetan-3-yloxy)benzoate. InChIKey: JVWKGZWCOBPFRN-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO4 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | methyl 4-bromo-3-(oxetan-3-yloxy)benzoate |
| InChIKey | JVWKGZWCOBPFRN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Br)OC2COC2 |
Computed by PubChem (NCBI)