CAS 834907-56-1 appears in our catalog under these names: 5-Bromo-2-ethoxy-4-formylphenyl acetate, 95%, 5-Bromo-2-ethoxy-4-formylphenyl acetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(5-bromo-2-ethoxy-4-formylphenyl) acetate (CAS 834907-56-1) is a chemical compound with the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. IUPAC name: (5-bromo-2-ethoxy-4-formylphenyl) acetate. InChIKey: OFOKVBIFOWJOJN-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO4 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | (5-bromo-2-ethoxy-4-formylphenyl) acetate |
| InChIKey | OFOKVBIFOWJOJN-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)C=O)Br)OC(=O)C |
Computed by PubChem (NCBI)