cas: 51832-31-6 — see every product listed under this CAS number, including other names
Dimethyl 4-aminophthalate 98% (CAS 51832-31-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A107963-100g |
| cas | 51832-31-6 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 26870.12 Pln | |
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 2217.12 Pln | |
| Ambeed | 10g | 3685.62 Pln | |
| Ambeed | 25g | 7139.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A107963 |
Dimethyl 4-aminobenzene-1,2-dicarboxylate (CAS 51832-31-6) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: dimethyl 4-aminobenzene-1,2-dicarboxylate. InChIKey: NTBHQNDXAJXRPU-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | dimethyl 4-aminobenzene-1,2-dicarboxylate |
| InChIKey | NTBHQNDXAJXRPU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)N)C(=O)OC |
Computed by PubChem (NCBI)