cas: 51832-31-6 — see every product listed under this CAS number, including other names
Dimethyl 4-aminophthalate, 98%, 98% (CAS 51832-31-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DKFG-100mg |
| cas | 51832-31-6 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 722.00 Pln | |
| Chemat | 5g | 2046.80 Pln | |
| Chemat | 10g | 2954.00 Pln | |
| Chemat | 25g | 6486.80 Pln | |
| Chemat | 100g | 20622.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dimethyl 4-aminobenzene-1,2-dicarboxylate (CAS 51832-31-6) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: dimethyl 4-aminobenzene-1,2-dicarboxylate. InChIKey: NTBHQNDXAJXRPU-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | dimethyl 4-aminobenzene-1,2-dicarboxylate |
| InChIKey | NTBHQNDXAJXRPU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)N)C(=O)OC |
Computed by PubChem (NCBI)