Dimethyl 4-fluorophthalate 95%
cas: 110706-50-8 — see every product listed under this CAS number, including other names
Dimethyl 4-fluorophthalate 95% (CAS 110706-50-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A196364-100mg |
| cas | 110706-50-8 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 654.06 Pln | |
| Ambeed | 25g | 2689.94 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A196364 |
Dimethyl 4-fluorobenzene-1,2-dicarboxylate (CAS 110706-50-8) is a chemical compound with the molecular formula C10H9FO4 and a molecular weight of 212.17 g/mol. IUPAC name: dimethyl 4-fluorobenzene-1,2-dicarboxylate. InChIKey: UPXQAPWOMHKSBU-UHFFFAOYSA-N.
| Molecular formula | C10H9FO4 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | dimethyl 4-fluorobenzene-1,2-dicarboxylate |
| InChIKey | UPXQAPWOMHKSBU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)F)C(=O)OC |
Computed by PubChem (NCBI)