cas: 110706-50-8 — see every product listed under this CAS number, including other names
Dimethyl 4-fluorophthalate, 95%, 95% (CAS 110706-50-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119UH5-100mg |
| cas | 110706-50-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 520.40 Pln | |
| Chemat | 25g | 2262.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Dimethyl 4-fluorobenzene-1,2-dicarboxylate (CAS 110706-50-8) is a chemical compound with the molecular formula C10H9FO4 and a molecular weight of 212.17 g/mol. IUPAC name: dimethyl 4-fluorobenzene-1,2-dicarboxylate. InChIKey: UPXQAPWOMHKSBU-UHFFFAOYSA-N.
| Molecular formula | C10H9FO4 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | dimethyl 4-fluorobenzene-1,2-dicarboxylate |
| InChIKey | UPXQAPWOMHKSBU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)F)C(=O)OC |
Computed by PubChem (NCBI)