cas: 7487-15-2 — see every product listed under this CAS number, including other names
Dimethyl naphthalene-1,4-dicarboxylate, 98%, 98% (CAS 7487-15-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1169TK-100mg |
| cas | 7487-15-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 434.00 Pln | |
| Chemat | 500mg | 333.20 Pln | |
| Chemat | 5g | 1542.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dimethyl naphthalene-1,4-dicarboxylate (CAS 7487-15-2) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: dimethyl naphthalene-1,4-dicarboxylate. InChIKey: OCSXMIBZIHMVCP-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | dimethyl naphthalene-1,4-dicarboxylate |
| InChIKey | OCSXMIBZIHMVCP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C2=CC=CC=C21)C(=O)OC |
Computed by PubChem (NCBI)