cas: 7487-15-2 — see every product listed under this CAS number, including other names
Dimethyl naphthalene-1,4-dicarboxylate, 98% (CAS 7487-15-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F775762-250MG |
| cas | 7487-15-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 500mg | 393.63 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 1924.34 Pln | |
| Fluorochem | 10g | 3611.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Dimethyl naphthalene-1,4-dicarboxylate (CAS 7487-15-2) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: dimethyl naphthalene-1,4-dicarboxylate. InChIKey: OCSXMIBZIHMVCP-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | dimethyl naphthalene-1,4-dicarboxylate |
| InChIKey | OCSXMIBZIHMVCP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C2=CC=CC=C21)C(=O)OC |
Computed by PubChem (NCBI)