cas: 5453-67-8 — see every product listed under this CAS number, including other names
Dimethyl pyridine-2,6-dicarboxylate, 98%, 98% (CAS 5453-67-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145QX-5g |
| cas | 5453-67-8 |
| size | 5g |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 98.00 Pln | |
| Chemat | 50g | 131.60 Pln | |
| Chemat | 100g | 194.00 Pln | |
| Chemat | 250g | 362.00 Pln | |
| Chemat | 500g | 681.60 Pln | |
| Chemat | 1kg | 1216.40 Pln | |
| Chemat | 5kg | 4046.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dimethyl pyridine-2,6-dicarboxylate (CAS 5453-67-8) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: dimethyl pyridine-2,6-dicarboxylate. InChIKey: SNQQJEJPJMXYTR-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | dimethyl pyridine-2,6-dicarboxylate |
| InChIKey | SNQQJEJPJMXYTR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=CC=C1)C(=O)OC |
Computed by PubChem (NCBI)