CAS 5453-67-8 appears in our catalog under these names: Dimethyl 2,6-Pyridinedicarboxylate, Dimethyl 2,6–pyridinedicarboxylate, Dimethyl pyridine-2,6-dicarboxylate, 98% , 2,6-Pyridinedicarboxylic acid dimethyl ester, Dimethyl 2,6-Pyridinedicarboxylate, >98.0%(GC). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 10g, 2,5g, 25g, 100g, 500g, 50g, 5g, 250g.
Dimethyl pyridine-2,6-dicarboxylate (CAS 5453-67-8) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: dimethyl pyridine-2,6-dicarboxylate. InChIKey: SNQQJEJPJMXYTR-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | dimethyl pyridine-2,6-dicarboxylate |
| InChIKey | SNQQJEJPJMXYTR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=CC=C1)C(=O)OC |
Computed by PubChem (NCBI)