cas: 312-63-0 — see every product listed under this CAS number, including other names
ELN484228, 99.50% (CAS 312-63-0) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 100 mg, 5 mg, 10 mg, 50 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-115038-10mM/1mL |
| cas | 312-63-0 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 384.71 Pln | |
| MedChemExpress | 100 mg | 1513.20 Pln | |
| MedChemExpress | 5 mg | 361.49 Pln | |
| MedChemExpress | 10 mg | 454.37 Pln | |
| MedChemExpress | 50 mg | 1030.22 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.50% |
N-(4-fluorophenyl)benzenesulfonamide (CAS 312-63-0) is a chemical compound with the molecular formula C12H10FNO2S and a molecular weight of 251.28 g/mol. IUPAC name: N-(4-fluorophenyl)benzenesulfonamide. InChIKey: AZORQGXJAXEIGC-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO2S |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | N-(4-fluorophenyl)benzenesulfonamide |
| InChIKey | AZORQGXJAXEIGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)