cas: 312-63-0 — see every product listed under this CAS number, including other names
ELN484228 (CAS 312-63-0) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 5mg, 10mM (in 1ml dmso), 50mg, 1g. Offered by: GLPBio, Biosynth.
| brand | GLPBio |
|---|---|
| catalog number | GC30936-10 |
| cas | 312-63-0 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 770.22 Pln | |
| GLPBio | 100mg | 1879.50 Pln | |
| GLPBio | 5mg | 667.25 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 770.22 Pln | |
| GLPBio | 50mg | 1374.00 Pln | |
| Biosynth | 1g | price on request | |
| Biosynth | 100mg | price on request |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
N-(4-fluorophenyl)benzenesulfonamide (CAS 312-63-0) is a chemical compound with the molecular formula C12H10FNO2S and a molecular weight of 251.28 g/mol. IUPAC name: N-(4-fluorophenyl)benzenesulfonamide. InChIKey: AZORQGXJAXEIGC-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO2S |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | N-(4-fluorophenyl)benzenesulfonamide |
| InChIKey | AZORQGXJAXEIGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)