cas: 312-63-0 — see every product listed under this CAS number, including other names
N-(4-Fluorophenyl)benzenesulfonamide, ≥98%, ≥98% (CAS 312-63-0) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118I36-10mg |
| cas | 312-63-0 |
| size | 10mg |
| availability | 0.8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 400.40 Pln | |
| Chemat | 50mg | 1197.20 Pln | |
| Chemat | 100mg | 2104.40 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
N-(4-fluorophenyl)benzenesulfonamide (CAS 312-63-0) is a chemical compound with the molecular formula C12H10FNO2S and a molecular weight of 251.28 g/mol. IUPAC name: N-(4-fluorophenyl)benzenesulfonamide. InChIKey: AZORQGXJAXEIGC-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO2S |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | N-(4-fluorophenyl)benzenesulfonamide |
| InChIKey | AZORQGXJAXEIGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)